C26H46N4O — CID 145443272
ethane;1-(1-ethyl-2,4b,7-trimethyl-1,3,4,4a,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-2-yl)-3-(5-methyltetrazol-2-yl)propan-2-one (PubChem CID 145443272) has the molecular formula C26H46N4O and a molecular weight of 430.68 g/mol. Its IUPAC name is ethane;1-(1-ethyl-2,4b,7-trimethyl-1,3,4,4a,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-2-yl)-3-(5-methyltetrazol-2-yl)propan-2-one.
| Compound Name | ethane;1-(1-ethyl-2,4b,7-trimethyl-1,3,4,4a,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-2-yl)-3-(5-methyltetrazol-2-yl)propan-2-one |
|---|---|
| PubChem CID | 145443272 |
| Molecular Formula | C26H46N4O |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.37 |
| IUPAC Name | ethane;1-(1-ethyl-2,4b,7-trimethyl-1,3,4,4a,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-2-yl)-3-(5-methyltetrazol-2-yl)propan-2-one |
| SMILES | CC.CCC1C2CCC3CC(C)CCC3(C)C2CCC1(C)CC(=O)Cn1nnc(C)n1 |
| InChI | InChI=1S/C24H40N4O.C2H6/c1-6-21-20-8-7-18-13-16(2)9-12-24(18,5)22(20)10-11-23(21,4)14-19(29)15-28-26-17(3)25-27-28;1-2/h16,18,20-22H,6-15H2,1-5H3;1-2H3 |
| InChIKey | CYQBRVSMBXMJSW-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |