C22H38O2 — CID 145443345
1-(1-ethyl-3-methoxy-2,4b,7-trimethyl-1,3,4,4a,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-2-yl)ethanone (PubChem CID 145443345) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is 1-(1-ethyl-3-methoxy-2,4b,7-trimethyl-1,3,4,4a,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-2-yl)ethanone.
| Compound Name | 1-(1-ethyl-3-methoxy-2,4b,7-trimethyl-1,3,4,4a,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-2-yl)ethanone |
|---|---|
| PubChem CID | 145443345 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | 1-(1-ethyl-3-methoxy-2,4b,7-trimethyl-1,3,4,4a,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-2-yl)ethanone |
| SMILES | CCC1C2CCC3CC(C)CCC3(C)C2CC(OC)C1(C)C(C)=O |
| InChI | InChI=1S/C22H38O2/c1-7-18-17-9-8-16-12-14(2)10-11-21(16,4)19(17)13-20(24-6)22(18,5)15(3)23/h14,16-20H,7-13H2,1-6H3 |
| InChIKey | YAPIHOGWEAGLCJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |