C16H12Br2OS — CID 145444721
1,6-dibromothioxanthen-9-one;prop-1-ene (PubChem CID 145444721) has the molecular formula C16H12Br2OS and a molecular weight of 412.15 g/mol. Its IUPAC name is 1,6-dibromothioxanthen-9-one;prop-1-ene.
| Compound Name | 1,6-dibromothioxanthen-9-one;prop-1-ene |
|---|---|
| PubChem CID | 145444721 |
| Molecular Formula | C16H12Br2OS |
| Molecular Weight | 412.15 g/mol |
| Exact Mass | 409.90 |
| IUPAC Name | 1,6-dibromothioxanthen-9-one;prop-1-ene |
| SMILES | C=CC.O=c1c2ccc(Br)cc2sc2cccc(Br)c12 |
| InChI | InChI=1S/C13H6Br2OS.C3H6/c14-7-4-5-8-11(6-7)17-10-3-1-2-9(15)12(10)13(8)16;1-3-2/h1-6H;3H,1H2,2H3 |
| InChIKey | VNRZOMHFAXDBHB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.15 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|