C13H6Br2OS — CID 154349910
1,2-dibromothioxanthen-9-one (PubChem CID 154349910) has the molecular formula C13H6Br2OS and a molecular weight of 370.07 g/mol. Its IUPAC name is 1,2-dibromothioxanthen-9-one.
| Compound Name | 1,2-dibromothioxanthen-9-one |
|---|---|
| PubChem CID | 154349910 |
| Molecular Formula | C13H6Br2OS |
| Molecular Weight | 370.07 g/mol |
| Exact Mass | 367.85 |
| IUPAC Name | 1,2-dibromothioxanthen-9-one |
| SMILES | O=c1c2ccccc2sc2ccc(Br)c(Br)c12 |
| InChI | InChI=1S/C13H6Br2OS/c14-8-5-6-10-11(12(8)15)13(16)7-3-1-2-4-9(7)17-10/h1-6H |
| InChIKey | UPMWZNBHMXTWOS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.07 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|