About 9-oxothioxanthene-1,2-dicarboxamide
9-oxothioxanthene-1,2-dicarboxamide (PubChem CID 174776414) has the molecular formula C15H10N2O3S
and a molecular weight of 298.32 g/mol. Its IUPAC name is 9-oxothioxanthene-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 9-oxothioxanthene-1,2-dicarboxamide |
| PubChem CID | 174776414 |
| Molecular Formula | C15H10N2O3S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 9-oxothioxanthene-1,2-dicarboxamide |
| SMILES | NC(=O)c1ccc2sc3ccccc3c(=O)c2c1C(N)=O |
| InChI | InChI=1S/C15H10N2O3S/c16-14(19)8-5-6-10-12(11(8)15(17)20)13(18)7-3-1-2-4-9(7)21-10/h1-6H,(H2,16,19)(H2,17,20) |
| InChIKey | AOJDHNWIQMPNAL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-oxothioxanthene-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-oxothioxanthene-1,2-dicarboxamide?
The IUPAC name of 9-oxothioxanthene-1,2-dicarboxamide (CID 174776414) is 9-oxothioxanthene-1,2-dicarboxamide.
What is the SMILES notation for 9-oxothioxanthene-1,2-dicarboxamide?
The canonical SMILES for 9-oxothioxanthene-1,2-dicarboxamide is NC(=O)c1ccc2sc3ccccc3c(=O)c2c1C(N)=O.
What is the InChIKey of 9-oxothioxanthene-1,2-dicarboxamide?
The InChIKey is AOJDHNWIQMPNAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O3S/c16-14(19)8-5-6-10-12(11(8)15(17)20)13(18)7-3-1-2-4-9(7)21-10/h1-6H,(H2,16,19)(H2,17,20).
What are the key properties of 9-oxothioxanthene-1,2-dicarboxamide?
9-oxothioxanthene-1,2-dicarboxamide has a molecular weight of 298.32 g/mol, XLogP of 1.61, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxothioxanthene-1,2-dicarboxamide is sourced from PubChem (CID 174776414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).