C15H10N2O3S — CID 174776414
9-oxothioxanthene-1,2-dicarboxamide (PubChem CID 174776414) has the molecular formula C15H10N2O3S and a molecular weight of 298.32 g/mol. Its IUPAC name is 9-oxothioxanthene-1,2-dicarboxamide.
| Compound Name | 9-oxothioxanthene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 174776414 |
| Molecular Formula | C15H10N2O3S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 9-oxothioxanthene-1,2-dicarboxamide |
| SMILES | NC(=O)c1ccc2sc3ccccc3c(=O)c2c1C(N)=O |
| InChI | InChI=1S/C15H10N2O3S/c16-14(19)8-5-6-10-12(11(8)15(17)20)13(18)7-3-1-2-4-9(7)21-10/h1-6H,(H2,16,19)(H2,17,20) |
| InChIKey | AOJDHNWIQMPNAL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|