C20H15ClFNO3S — CID 145445866
2-[3-(6-chloro-1-oxo-2H-thiochromen-4-yl)-5-fluoro-2-methylindol-1-yl]acetic acid (PubChem CID 145445866) has the molecular formula C20H15ClFNO3S and a molecular weight of 403.86 g/mol. Its IUPAC name is 2-[3-(6-chloro-1-oxo-2H-thiochromen-4-yl)-5-fluoro-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-(6-chloro-1-oxo-2H-thiochromen-4-yl)-5-fluoro-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 145445866 |
| Molecular Formula | C20H15ClFNO3S |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 2-[3-(6-chloro-1-oxo-2H-thiochromen-4-yl)-5-fluoro-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(C2=CCS(=O)c3ccc(Cl)cc32)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C20H15ClFNO3S/c1-11-20(14-6-7-27(26)18-5-2-12(21)8-15(14)18)16-9-13(22)3-4-17(16)23(11)10-19(24)25/h2-6,8-9H,7,10H2,1H3,(H,24,25) |
| InChIKey | QFFBIVHSIRGECY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |