C19H13ClFNO3S — CID 163586931
2-[6-chloro-3-(5-fluoro-1-oxo-1-benzothiophen-3-yl)-2-methylindol-1-yl]acetic acid (PubChem CID 163586931) has the molecular formula C19H13ClFNO3S and a molecular weight of 389.84 g/mol. Its IUPAC name is 2-[6-chloro-3-(5-fluoro-1-oxo-1-benzothiophen-3-yl)-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[6-chloro-3-(5-fluoro-1-oxo-1-benzothiophen-3-yl)-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 163586931 |
| Molecular Formula | C19H13ClFNO3S |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 2-[6-chloro-3-(5-fluoro-1-oxo-1-benzothiophen-3-yl)-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(C2=CS(=O)c3ccc(F)cc32)c2ccc(Cl)cc2n1CC(=O)O |
| InChI | InChI=1S/C19H13ClFNO3S/c1-10-19(15-9-26(25)17-5-3-12(21)7-14(15)17)13-4-2-11(20)6-16(13)22(10)8-18(23)24/h2-7,9H,8H2,1H3,(H,23,24) |
| InChIKey | GMGKYRBJKQOMDN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |