C20H16FNO2S — CID 145445834
2-[6-fluoro-2-methyl-3-(5-methyl-1-benzothiophen-3-yl)indol-1-yl]acetic acid (PubChem CID 145445834) has the molecular formula C20H16FNO2S and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-[6-fluoro-2-methyl-3-(5-methyl-1-benzothiophen-3-yl)indol-1-yl]acetic acid.
| Compound Name | 2-[6-fluoro-2-methyl-3-(5-methyl-1-benzothiophen-3-yl)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 145445834 |
| Molecular Formula | C20H16FNO2S |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-[6-fluoro-2-methyl-3-(5-methyl-1-benzothiophen-3-yl)indol-1-yl]acetic acid |
| SMILES | Cc1ccc2scc(-c3c(C)n(CC(=O)O)c4cc(F)ccc34)c2c1 |
| InChI | InChI=1S/C20H16FNO2S/c1-11-3-6-18-15(7-11)16(10-25-18)20-12(2)22(9-19(23)24)17-8-13(21)4-5-14(17)20/h3-8,10H,9H2,1-2H3,(H,23,24) |
| InChIKey | QZNOJLSKQCHJES-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |