C18H13FN2O2S — CID 54160910
2-[3-(4-fluoro-1,3-benzothiazol-2-yl)-2-methylindol-1-yl]acetic acid (PubChem CID 54160910) has the molecular formula C18H13FN2O2S and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-[3-(4-fluoro-1,3-benzothiazol-2-yl)-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-(4-fluoro-1,3-benzothiazol-2-yl)-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 54160910 |
| Molecular Formula | C18H13FN2O2S |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-[3-(4-fluoro-1,3-benzothiazol-2-yl)-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(-c2nc3c(F)cccc3s2)c2ccccc2n1CC(=O)O |
| InChI | InChI=1S/C18H13FN2O2S/c1-10-16(18-20-17-12(19)6-4-8-14(17)24-18)11-5-2-3-7-13(11)21(10)9-15(22)23/h2-8H,9H2,1H3,(H,22,23) |
| InChIKey | OOIGFBKZBRJGDJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |