2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid

C16H16N2O2S — CID 22689380

IUPAC2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid
SMILESCCn1c(C)c(-c2nc(CC(=O)O)cs2)c2ccccc21
InChIInChI=1S/C16H16N2O2S/c1-3-18-10(2)15(12-6-4-5-7-13(12)18)16-17-11(9-21-16)8-14(19)20/h4-7,9H,3,8H2,1-2H3,(H,19,20)
InChIKeyNOAFNQMLLRFYAH-UHFFFAOYSA-N
MW300.38 g/mol
LogP3.72
Rot. Bonds4

About 2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid

2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 22689380) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid
PubChem CID22689380
Molecular FormulaC16H16N2O2S
Molecular Weight300.38 g/mol
Exact Mass300.09
IUPAC Name2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid
SMILESCCn1c(C)c(-c2nc(CC(=O)O)cs2)c2ccccc21
InChIInChI=1S/C16H16N2O2S/c1-3-18-10(2)15(12-6-4-5-7-13(12)18)16-17-11(9-21-16)8-14(19)20/h4-7,9H,3,8H2,1-2H3,(H,19,20)
InChIKeyNOAFNQMLLRFYAH-UHFFFAOYSA-N
XLogP3.72
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.38
LogP ≤ 53.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid (CID 22689380) is 2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid is CCn1c(C)c(-c2nc(CC(=O)O)cs2)c2ccccc21.
What is the InChIKey of 2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is NOAFNQMLLRFYAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S/c1-3-18-10(2)15(12-6-4-5-7-13(12)18)16-17-11(9-21-16)8-14(19)20/h4-7,9H,3,8H2,1-2H3,(H,19,20).
What are the key properties of 2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid?
2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 300.38 g/mol, XLogP of 3.72, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1-ethyl-2-methylindol-3-yl)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 22689380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).