C15H25NO2 — CID 145446733
ethyl 5-cyclooctyl-3,4-dihydro-2H-pyrrole-2-carboxylate (PubChem CID 145446733) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is ethyl 5-cyclooctyl-3,4-dihydro-2H-pyrrole-2-carboxylate.
| Compound Name | ethyl 5-cyclooctyl-3,4-dihydro-2H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 145446733 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | ethyl 5-cyclooctyl-3,4-dihydro-2H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)C1CCC(C2CCCCCCC2)=N1 |
| InChI | InChI=1S/C15H25NO2/c1-2-18-15(17)14-11-10-13(16-14)12-8-6-4-3-5-7-9-12/h12,14H,2-11H2,1H3 |
| InChIKey | SJTDGKUKYBJDHH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |