C12H12F2N2O2 — CID 67462542
ethyl (2R)-5-(2,6-difluoro-3-pyridinyl)-3,4-dihydro-2H-pyrrole-2-carboxylate (PubChem CID 67462542) has the molecular formula C12H12F2N2O2 and a molecular weight of 254.24 g/mol. Its IUPAC name is ethyl (2R)-5-(2,6-difluoro-3-pyridinyl)-3,4-dihydro-2H-pyrrole-2-carboxylate.
| Compound Name | ethyl (2R)-5-(2,6-difluoro-3-pyridinyl)-3,4-dihydro-2H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 67462542 |
| Molecular Formula | C12H12F2N2O2 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | ethyl (2R)-5-(2,6-difluoro-3-pyridinyl)-3,4-dihydro-2H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC(c2ccc(F)nc2F)=N1 |
| InChI | InChI=1S/C12H12F2N2O2/c1-2-18-12(17)9-5-4-8(15-9)7-3-6-10(13)16-11(7)14/h3,6,9H,2,4-5H2,1H3/t9-/m1/s1 |
| InChIKey | DXJOYYVFOULXEC-SECBINFHSA-N |
| XLogP | 1.87 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|