About ethyl (2R)-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate
ethyl (2R)-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate (PubChem CID 124506439) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is ethyl (2R)-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate.
Analyze ethyl (2R)-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate?
The IUPAC name of ethyl (2R)-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate (CID 124506439) is ethyl (2R)-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate.
What is the SMILES notation for ethyl (2R)-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate?
The canonical SMILES for ethyl (2R)-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate is CCOC(=O)[C@H]1CCC(C)=N1.
What is the InChIKey of ethyl (2R)-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate?
The InChIKey is FMTWCIPDRLFSMV-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H13NO2/c1-3-11-8(10)7-5-4-6(2)9-7/h7H,3-5H2,1-2H3/t7-/m1/s1.
What are the key properties of ethyl (2R)-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate?
ethyl (2R)-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate has a molecular weight of 155.20 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate is sourced from PubChem (CID 124506439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).