C22H22O — CID 145447484
4-cyclohepta-1,3,6-trien-1-yldibenzofuran;propane (PubChem CID 145447484) has the molecular formula C22H22O and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-cyclohepta-1,3,6-trien-1-yldibenzofuran;propane.
| Compound Name | 4-cyclohepta-1,3,6-trien-1-yldibenzofuran;propane |
|---|---|
| PubChem CID | 145447484 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 4-cyclohepta-1,3,6-trien-1-yldibenzofuran;propane |
| SMILES | C1=CCC=CC(c2cccc3c2oc2ccccc23)=C1.CCC |
| InChI | InChI=1S/C19H14O.C3H8/c1-2-4-9-14(8-3-1)15-11-7-12-17-16-10-5-6-13-18(16)20-19(15)17;1-3-2/h1,3-13H,2H2;3H2,1-2H3 |
| InChIKey | XNNFGRHWCVUEFF-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |