C51H39N3O — CID 145447663
N-benzyl-N'-[2-(7-fluoranthen-3-yldibenzofuran-1-yl)benzenecarboximidoyl]cyclohepta-1,3,6-triene-1-carboximidamide;methane (PubChem CID 145447663) has the molecular formula C51H39N3O and a molecular weight of 709.89 g/mol. Its IUPAC name is N-benzyl-N'-[2-(7-fluoranthen-3-yldibenzofuran-1-yl)benzenecarboximidoyl]cyclohepta-1,3,6-triene-1-carboximidamide;methane.
| Compound Name | N-benzyl-N'-[2-(7-fluoranthen-3-yldibenzofuran-1-yl)benzenecarboximidoyl]cyclohepta-1,3,6-triene-1-carboximidamide;methane |
|---|---|
| PubChem CID | 145447663 |
| Molecular Formula | C51H39N3O |
| Molecular Weight | 709.89 g/mol |
| Exact Mass | 709.31 |
| IUPAC Name | N-benzyl-N'-[2-(7-fluoranthen-3-yldibenzofuran-1-yl)benzenecarboximidoyl]cyclohepta-1,3,6-triene-1-carboximidamide;methane |
| SMILES | C.[H]/N=C(\N=C(/NCc1ccccc1)C1=CC=CCC=C1)c1ccccc1-c1cccc2oc3cc(-c4ccc5c6c(cccc46)-c4ccccc4-5)ccc3c12 |
| InChI | InChI=1S/C50H35N3O.CH4/c51-49(53-50(33-16-6-1-2-7-17-33)52-31-32-14-4-3-5-15-32)43-21-11-10-20-38(43)41-24-13-25-45-48(41)44-27-26-34(30-46(44)54-45)35-28-29-42-37-19-9-8-18-36(37)40-23-12-22-39(35)47(40)42;/h1,3-30H,2,31H2,(H2,51,52,53);1H4 |
| InChIKey | NNWBVPWCRKLPKZ-UHFFFAOYSA-N |
| XLogP | 13.31 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.89 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|