About ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione
ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione (PubChem CID 145449953) has the molecular formula C17H23FO2
and a molecular weight of 278.37 g/mol. Its IUPAC name is ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione.
Molecular Properties
| Compound Name | ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione |
| PubChem CID | 145449953 |
| Molecular Formula | C17H23FO2 |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione |
| SMILES | C=C(/C=C\CC)C(=O)C(=O)c1ccccc1.CC.CF |
| InChI | InChI=1S/C14H14O2.C2H6.CH3F/c1-3-4-8-11(2)13(15)14(16)12-9-6-5-7-10-12;2*1-2/h4-10H,2-3H2,1H3;1-2H3;1H3/b8-4-;; |
| InChIKey | WMXJISNWWRAGQL-QSELPZCXSA-N |
| XLogP | 4.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione?
The IUPAC name of ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione (CID 145449953) is ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione.
What is the SMILES notation for ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione?
The canonical SMILES for ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione is C=C(/C=C\CC)C(=O)C(=O)c1ccccc1.CC.CF.
What is the InChIKey of ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione?
The InChIKey is WMXJISNWWRAGQL-QSELPZCXSA-N. The full InChI is InChI=1S/C14H14O2.C2H6.CH3F/c1-3-4-8-11(2)13(15)14(16)12-9-6-5-7-10-12;2*1-2/h4-10H,2-3H2,1H3;1-2H3;1H3/b8-4-;;.
What are the key properties of ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione?
ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione has a molecular weight of 278.37 g/mol, XLogP of 4.57, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;fluoromethane;(Z)-3-methylidene-1-phenylhept-4-ene-1,2-dione is sourced from PubChem (CID 145449953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).