About 2-tert-butylphenol;cyclobutyloxymethylbenzene
2-tert-butylphenol;cyclobutyloxymethylbenzene (PubChem CID 145450512) has the molecular formula C21H28O2
and a molecular weight of 312.45 g/mol. Its IUPAC name is 2-tert-butylphenol;cyclobutyloxymethylbenzene.
Molecular Properties
| Compound Name | 2-tert-butylphenol;cyclobutyloxymethylbenzene |
| PubChem CID | 145450512 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 2-tert-butylphenol;cyclobutyloxymethylbenzene |
| SMILES | CC(C)(C)c1ccccc1O.c1ccc(COC2CCC2)cc1 |
| InChI | InChI=1S/C11H14O.C10H14O/c1-2-5-10(6-3-1)9-12-11-7-4-8-11;1-10(2,3)8-6-4-5-7-9(8)11/h1-3,5-6,11H,4,7-9H2;4-7,11H,1-3H3 |
| InChIKey | FWVUIQDPDRLXTI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butylphenol;cyclobutyloxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylphenol;cyclobutyloxymethylbenzene?
The IUPAC name of 2-tert-butylphenol;cyclobutyloxymethylbenzene (CID 145450512) is 2-tert-butylphenol;cyclobutyloxymethylbenzene.
What is the SMILES notation for 2-tert-butylphenol;cyclobutyloxymethylbenzene?
The canonical SMILES for 2-tert-butylphenol;cyclobutyloxymethylbenzene is CC(C)(C)c1ccccc1O.c1ccc(COC2CCC2)cc1.
What is the InChIKey of 2-tert-butylphenol;cyclobutyloxymethylbenzene?
The InChIKey is FWVUIQDPDRLXTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O.C10H14O/c1-2-5-10(6-3-1)9-12-11-7-4-8-11;1-10(2,3)8-6-4-5-7-9(8)11/h1-3,5-6,11H,4,7-9H2;4-7,11H,1-3H3.
What are the key properties of 2-tert-butylphenol;cyclobutyloxymethylbenzene?
2-tert-butylphenol;cyclobutyloxymethylbenzene has a molecular weight of 312.45 g/mol, XLogP of 5.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylphenol;cyclobutyloxymethylbenzene is sourced from PubChem (CID 145450512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).