C16H13F3O3 — CID 145453131
(1R,3aR,9bR)-3a-acetyl-2-methylidene-1-(trifluoromethyl)-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one (PubChem CID 145453131) has the molecular formula C16H13F3O3 and a molecular weight of 310.27 g/mol. Its IUPAC name is (1R,3aR,9bR)-3a-acetyl-2-methylidene-1-(trifluoromethyl)-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one.
| Compound Name | (1R,3aR,9bR)-3a-acetyl-2-methylidene-1-(trifluoromethyl)-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one |
|---|---|
| PubChem CID | 145453131 |
| Molecular Formula | C16H13F3O3 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (1R,3aR,9bR)-3a-acetyl-2-methylidene-1-(trifluoromethyl)-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one |
| SMILES | C=C1C[C@@]2(C(C)=O)C(=O)Oc3ccccc3[C@H]2[C@H]1C(F)(F)F |
| InChI | InChI=1S/C16H13F3O3/c1-8-7-15(9(2)20)13(12(8)16(17,18)19)10-5-3-4-6-11(10)22-14(15)21/h3-6,12-13H,1,7H2,2H3/t12-,13-,15-/m0/s1 |
| InChIKey | XOFXSPIUKDDQDM-YDHLFZDLSA-N |
| XLogP | 3.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|