C29H55N3O3 — CID 145453486
(E)-N,N-bis(4-acetamidobutyl)-15-methylhexadec-6-enamide (PubChem CID 145453486) has the molecular formula C29H55N3O3 and a molecular weight of 493.78 g/mol. Its IUPAC name is (E)-N,N-bis(4-acetamidobutyl)-15-methylhexadec-6-enamide.
| Compound Name | (E)-N,N-bis(4-acetamidobutyl)-15-methylhexadec-6-enamide |
|---|---|
| PubChem CID | 145453486 |
| Molecular Formula | C29H55N3O3 |
| Molecular Weight | 493.78 g/mol |
| Exact Mass | 493.42 |
| IUPAC Name | (E)-N,N-bis(4-acetamidobutyl)-15-methylhexadec-6-enamide |
| SMILES | CC(=O)NCCCCN(CCCCNC(C)=O)C(=O)CCCC/C=C/CCCCCCCC(C)C |
| InChI | InChI=1S/C29H55N3O3/c1-26(2)20-14-12-10-8-6-5-7-9-11-13-15-21-29(35)32(24-18-16-22-30-27(3)33)25-19-17-23-31-28(4)34/h7,9,26H,5-6,8,10-25H2,1-4H3,(H,30,33)(H,31,34)/b9-7+ |
| InChIKey | JUKQCFLROLXSKB-VQHVLOKHSA-N |
| XLogP | 6.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.78 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|