C19H43Cl2N3O — CID 11188780
N,N-bis(2-aminoethyl)-13-methyltetradecanamide;dihydrochloride (PubChem CID 11188780) has the molecular formula C19H43Cl2N3O and a molecular weight of 400.48 g/mol. Its IUPAC name is N,N-bis(2-aminoethyl)-13-methyltetradecanamide;dihydrochloride.
| Compound Name | N,N-bis(2-aminoethyl)-13-methyltetradecanamide;dihydrochloride |
|---|---|
| PubChem CID | 11188780 |
| Molecular Formula | C19H43Cl2N3O |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | N,N-bis(2-aminoethyl)-13-methyltetradecanamide;dihydrochloride |
| SMILES | CC(C)CCCCCCCCCCCC(=O)N(CCN)CCN.Cl.Cl |
| InChI | InChI=1S/C19H41N3O.2ClH/c1-18(2)12-10-8-6-4-3-5-7-9-11-13-19(23)22(16-14-20)17-15-21;;/h18H,3-17,20-21H2,1-2H3;2*1H |
| InChIKey | MUJXIVHNCNDBJC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|