C15H33ClN2O — CID 119672594
4-(methylamino)-N,N-bis(3-methylbutyl)butanamide;hydrochloride (PubChem CID 119672594) has the molecular formula C15H33ClN2O and a molecular weight of 292.90 g/mol. Its IUPAC name is 4-(methylamino)-N,N-bis(3-methylbutyl)butanamide;hydrochloride.
| Compound Name | 4-(methylamino)-N,N-bis(3-methylbutyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119672594 |
| Molecular Formula | C15H33ClN2O |
| Molecular Weight | 292.90 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 4-(methylamino)-N,N-bis(3-methylbutyl)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)N(CCC(C)C)CCC(C)C.Cl |
| InChI | InChI=1S/C15H32N2O.ClH/c1-13(2)8-11-17(12-9-14(3)4)15(18)7-6-10-16-5;/h13-14,16H,6-12H2,1-5H3;1H |
| InChIKey | JAONQRYQUUBJLP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.90 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|