C14H30N2O — CID 60686802
2-(ethylamino)-N,N-bis(3-methylbutyl)acetamide (PubChem CID 60686802) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 2-(ethylamino)-N,N-bis(3-methylbutyl)acetamide.
| Compound Name | 2-(ethylamino)-N,N-bis(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 60686802 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 2-(ethylamino)-N,N-bis(3-methylbutyl)acetamide |
| SMILES | CCNCC(=O)N(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C14H30N2O/c1-6-15-11-14(17)16(9-7-12(2)3)10-8-13(4)5/h12-13,15H,6-11H2,1-5H3 |
| InChIKey | QJTYVZQKGUBVSK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |