C15H34N4O — CID 91126483
4-(ethylamino)-N,N-bis[2-(ethylamino)ethyl]pentanamide (PubChem CID 91126483) has the molecular formula C15H34N4O and a molecular weight of 286.46 g/mol. Its IUPAC name is 4-(ethylamino)-N,N-bis[2-(ethylamino)ethyl]pentanamide.
| Compound Name | 4-(ethylamino)-N,N-bis[2-(ethylamino)ethyl]pentanamide |
|---|---|
| PubChem CID | 91126483 |
| Molecular Formula | C15H34N4O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | 4-(ethylamino)-N,N-bis[2-(ethylamino)ethyl]pentanamide |
| SMILES | CCNCCN(CCNCC)C(=O)CCC(C)NCC |
| InChI | InChI=1S/C15H34N4O/c1-5-16-10-12-19(13-11-17-6-2)15(20)9-8-14(4)18-7-3/h14,16-18H,5-13H2,1-4H3 |
| InChIKey | DRSBDNDIGXTBOS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|