C23H27LiN4OS-2 — CID 145459795
lithium;carbanide;3-[5-[(2S,3S)-2-(iminomethylamino)-4-oxo-3-(1-propan-2-ylazetidin-3-yl)butan-2-yl]thiophen-3-yl]benzonitrile (PubChem CID 145459795) has the molecular formula C23H27LiN4OS-2 and a molecular weight of 414.50 g/mol. Its IUPAC name is lithium;carbanide;3-[5-[(2S,3S)-2-(iminomethylamino)-4-oxo-3-(1-propan-2-ylazetidin-3-yl)butan-2-yl]thiophen-3-yl]benzonitrile.
| Compound Name | lithium;carbanide;3-[5-[(2S,3S)-2-(iminomethylamino)-4-oxo-3-(1-propan-2-ylazetidin-3-yl)butan-2-yl]thiophen-3-yl]benzonitrile |
|---|---|
| PubChem CID | 145459795 |
| Molecular Formula | C23H27LiN4OS-2 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | lithium;carbanide;3-[5-[(2S,3S)-2-(iminomethylamino)-4-oxo-3-(1-propan-2-ylazetidin-3-yl)butan-2-yl]thiophen-3-yl]benzonitrile |
| SMILES | [CH3-].[H]/N=[C-]\N[C@](C)(c1cc(-c2cccc(C#N)c2)cs1)[C@@H]([C-]=O)C1CN(C(C)C)C1.[Li+] |
| InChI | InChI=1S/C22H24N4OS.CH3.Li/c1-15(2)26-10-19(11-26)20(12-27)22(3,25-14-24)21-8-18(13-28-21)17-6-4-5-16(7-17)9-23;;/h4-8,13,15,19-20H,10-11H2,1-3H3,(H2,24,25);1H3;/q-2;-1;+1/t20-,22-;;/m0../s1 |
| InChIKey | SWFWSNMMGWYFBL-HWELVIDPSA-N |
| XLogP | 1.10 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|