C18H15FN4OS — CID 149262800
3-[5-[(5R)-5-(fluoromethyl)-2-imino-1-methyl-7-oxo-6H-1,4-diazepin-5-yl]thiophen-3-yl]benzonitrile (PubChem CID 149262800) has the molecular formula C18H15FN4OS and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-[5-[(5R)-5-(fluoromethyl)-2-imino-1-methyl-7-oxo-6H-1,4-diazepin-5-yl]thiophen-3-yl]benzonitrile.
| Compound Name | 3-[5-[(5R)-5-(fluoromethyl)-2-imino-1-methyl-7-oxo-6H-1,4-diazepin-5-yl]thiophen-3-yl]benzonitrile |
|---|---|
| PubChem CID | 149262800 |
| Molecular Formula | C18H15FN4OS |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 3-[5-[(5R)-5-(fluoromethyl)-2-imino-1-methyl-7-oxo-6H-1,4-diazepin-5-yl]thiophen-3-yl]benzonitrile |
| SMILES | [H]/N=C1\C=N[C@](CF)(c2cc(-c3cccc(C#N)c3)cs2)CC(=O)N1C |
| InChI | InChI=1S/C18H15FN4OS/c1-23-16(21)9-22-18(11-19,7-17(23)24)15-6-14(10-25-15)13-4-2-3-12(5-13)8-20/h2-6,9-10,21H,7,11H2,1H3/b21-16+/t18-/m1/s1 |
| InChIKey | XPOIKUFDFIZKSM-WKSXIXGESA-N |
| XLogP | 3.36 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|