C19H16N4OS — CID 153047231
5-[5-[(4S)-2-imino-1,4-dimethyl-6-oxopiperidin-4-yl]thiophen-3-yl]benzene-1,3-dicarbonitrile (PubChem CID 153047231) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is 5-[5-[(4S)-2-imino-1,4-dimethyl-6-oxopiperidin-4-yl]thiophen-3-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[5-[(4S)-2-imino-1,4-dimethyl-6-oxopiperidin-4-yl]thiophen-3-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 153047231 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 5-[5-[(4S)-2-imino-1,4-dimethyl-6-oxopiperidin-4-yl]thiophen-3-yl]benzene-1,3-dicarbonitrile |
| SMILES | [H]/N=C1\C[C@](C)(c2cc(-c3cc(C#N)cc(C#N)c3)cs2)CC(=O)N1C |
| InChI | InChI=1S/C19H16N4OS/c1-19(7-17(22)23(2)18(24)8-19)16-6-15(11-25-16)14-4-12(9-20)3-13(5-14)10-21/h3-6,11,22H,7-8H2,1-2H3/b22-17+/t19-/m0/s1 |
| InChIKey | VGVORPSTHAIUTC-WXNAFCGMSA-N |
| XLogP | 3.65 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|