C19H16FN3OS — CID 159650573
2-fluoro-5-[5-[(4S)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]thiophen-3-yl]benzonitrile (PubChem CID 159650573) has the molecular formula C19H16FN3OS and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-fluoro-5-[5-[(4S)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]thiophen-3-yl]benzonitrile.
| Compound Name | 2-fluoro-5-[5-[(4S)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]thiophen-3-yl]benzonitrile |
|---|---|
| PubChem CID | 159650573 |
| Molecular Formula | C19H16FN3OS |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-fluoro-5-[5-[(4S)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]thiophen-3-yl]benzonitrile |
| SMILES | [H]/N=C1/C[C@](C)(c2cc(-c3ccc(F)c(C#N)c3)cs2)C(=C)C(=O)N1C |
| InChI | InChI=1S/C19H16FN3OS/c1-11-18(24)23(3)17(22)8-19(11,2)16-7-14(10-25-16)12-4-5-15(20)13(6-12)9-21/h4-7,10,22H,1,8H2,2-3H3/b22-17-/t19-/m0/s1 |
| InChIKey | MRMZWGMLIONAMS-WDUNQMNWSA-N |
| XLogP | 4.08 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|