C21H19N3O — CID 91340486
3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile (PubChem CID 91340486) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile.
| Compound Name | 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 91340486 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile |
| SMILES | [H]/N=C1/C[C@](C)(c2cccc(-c3cccc(C#N)c3)c2)C(=C)C(=O)N1C |
| InChI | InChI=1S/C21H19N3O/c1-14-20(25)24(3)19(23)12-21(14,2)18-9-5-8-17(11-18)16-7-4-6-15(10-16)13-22/h4-11,23H,1,12H2,2-3H3/b23-19-/t21-/m0/s1 |
| InChIKey | BORGJMIUGHFEQQ-HFBCPUAESA-N |
| XLogP | 3.88 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|