About 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile
3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile (PubChem CID 91340486) has the molecular formula C21H19N3O
and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile |
| PubChem CID | 91340486 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile |
| SMILES | [H]/N=C1/C[C@](C)(c2cccc(-c3cccc(C#N)c3)c2)C(=C)C(=O)N1C |
| InChI | InChI=1S/C21H19N3O/c1-14-20(25)24(3)19(23)12-21(14,2)18-9-5-8-17(11-18)16-7-4-6-15(10-16)13-22/h4-11,23H,1,12H2,2-3H3/b23-19-/t21-/m0/s1 |
| InChIKey | BORGJMIUGHFEQQ-HFBCPUAESA-N |
| XLogP | 3.88 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile?
The IUPAC name of 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile (CID 91340486) is 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile.
What is the SMILES notation for 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile?
The canonical SMILES for 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile is [H]/N=C1/C[C@](C)(c2cccc(-c3cccc(C#N)c3)c2)C(=C)C(=O)N1C.
What is the InChIKey of 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile?
The InChIKey is BORGJMIUGHFEQQ-HFBCPUAESA-N. The full InChI is InChI=1S/C21H19N3O/c1-14-20(25)24(3)19(23)12-21(14,2)18-9-5-8-17(11-18)16-7-4-6-15(10-16)13-22/h4-11,23H,1,12H2,2-3H3/b23-19-/t21-/m0/s1.
What are the key properties of 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile?
3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile has a molecular weight of 329.40 g/mol, XLogP of 3.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(4R)-6-imino-1,4-dimethyl-3-methylidene-2-oxopiperidin-4-yl]phenyl]benzonitrile is sourced from PubChem (CID 91340486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).