C18H17FN4OS — CID 123946219
2-fluoro-5-[5-(2-imino-1,3,4-trimethyl-6-oxo-1,3-diazinan-4-yl)thiophen-3-yl]benzonitrile (PubChem CID 123946219) has the molecular formula C18H17FN4OS and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-fluoro-5-[5-(2-imino-1,3,4-trimethyl-6-oxo-1,3-diazinan-4-yl)thiophen-3-yl]benzonitrile.
| Compound Name | 2-fluoro-5-[5-(2-imino-1,3,4-trimethyl-6-oxo-1,3-diazinan-4-yl)thiophen-3-yl]benzonitrile |
|---|---|
| PubChem CID | 123946219 |
| Molecular Formula | C18H17FN4OS |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-fluoro-5-[5-(2-imino-1,3,4-trimethyl-6-oxo-1,3-diazinan-4-yl)thiophen-3-yl]benzonitrile |
| SMILES | [H]/N=C1\N(C)C(=O)CC(C)(c2cc(-c3ccc(F)c(C#N)c3)cs2)N1C |
| InChI | InChI=1S/C18H17FN4OS/c1-18(8-16(24)22(2)17(21)23(18)3)15-7-13(10-25-15)11-4-5-14(19)12(6-11)9-20/h4-7,10,21H,8H2,1-3H3/b21-17+ |
| InChIKey | RSNRYFQSPBBHMV-HEHNFIMWSA-N |
| XLogP | 3.37 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|