C26H25NOS — CID 145460437
3-[5-[(2S)-4,6-dimethyl-3-oxo-2-phenylhept-6-en-2-yl]thiophen-3-yl]benzonitrile (PubChem CID 145460437) has the molecular formula C26H25NOS and a molecular weight of 399.56 g/mol. Its IUPAC name is 3-[5-[(2S)-4,6-dimethyl-3-oxo-2-phenylhept-6-en-2-yl]thiophen-3-yl]benzonitrile.
| Compound Name | 3-[5-[(2S)-4,6-dimethyl-3-oxo-2-phenylhept-6-en-2-yl]thiophen-3-yl]benzonitrile |
|---|---|
| PubChem CID | 145460437 |
| Molecular Formula | C26H25NOS |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 3-[5-[(2S)-4,6-dimethyl-3-oxo-2-phenylhept-6-en-2-yl]thiophen-3-yl]benzonitrile |
| SMILES | C=C(C)CC(C)C(=O)[C@](C)(c1ccccc1)c1cc(-c2cccc(C#N)c2)cs1 |
| InChI | InChI=1S/C26H25NOS/c1-18(2)13-19(3)25(28)26(4,23-11-6-5-7-12-23)24-15-22(17-29-24)21-10-8-9-20(14-21)16-27/h5-12,14-15,17,19H,1,13H2,2-4H3/t19?,26-/m1/s1 |
| InChIKey | ZHKWXOFGVXGMIY-COTLDPOVSA-N |
| XLogP | 6.76 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|