C13H13N — CID 169282312
3-(3-methylpenta-1,4-dien-3-yl)benzonitrile (PubChem CID 169282312) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-(3-methylpenta-1,4-dien-3-yl)benzonitrile.
| Compound Name | 3-(3-methylpenta-1,4-dien-3-yl)benzonitrile |
|---|---|
| PubChem CID | 169282312 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 3-(3-methylpenta-1,4-dien-3-yl)benzonitrile |
| SMILES | C=CC(C)(C=C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C13H13N/c1-4-13(3,5-2)12-8-6-7-11(9-12)10-14/h4-9H,1-2H2,3H3 |
| InChIKey | FBYBSSJZZKMNIR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|