C13H13F3O — CID 169282369
1-(3-methylpenta-1,4-dien-3-yl)-3-(trifluoromethoxy)benzene (PubChem CID 169282369) has the molecular formula C13H13F3O and a molecular weight of 242.24 g/mol. Its IUPAC name is 1-(3-methylpenta-1,4-dien-3-yl)-3-(trifluoromethoxy)benzene.
| Compound Name | 1-(3-methylpenta-1,4-dien-3-yl)-3-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 169282369 |
| Molecular Formula | C13H13F3O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-(3-methylpenta-1,4-dien-3-yl)-3-(trifluoromethoxy)benzene |
| SMILES | C=CC(C)(C=C)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3O/c1-4-12(3,5-2)10-7-6-8-11(9-10)17-13(14,15)16/h4-9H,1-2H2,3H3 |
| InChIKey | DPYVWKMOEPXXLN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|