C24H28N6OS — CID 145460008
acetonitrile;N-methyl-N-(N'-methylcarbamimidoyl)-2-(4-phenylthiophen-2-yl)-4-(pyridin-3-ylamino)butanamide (PubChem CID 145460008) has the molecular formula C24H28N6OS and a molecular weight of 448.60 g/mol. Its IUPAC name is acetonitrile;N-methyl-N-(N'-methylcarbamimidoyl)-2-(4-phenylthiophen-2-yl)-4-(pyridin-3-ylamino)butanamide.
| Compound Name | acetonitrile;N-methyl-N-(N'-methylcarbamimidoyl)-2-(4-phenylthiophen-2-yl)-4-(pyridin-3-ylamino)butanamide |
|---|---|
| PubChem CID | 145460008 |
| Molecular Formula | C24H28N6OS |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | acetonitrile;N-methyl-N-(N'-methylcarbamimidoyl)-2-(4-phenylthiophen-2-yl)-4-(pyridin-3-ylamino)butanamide |
| SMILES | C/N=C(\N)N(C)C(=O)C(CCNc1cccnc1)c1cc(-c2ccccc2)cs1.CC#N |
| InChI | InChI=1S/C22H25N5OS.C2H3N/c1-24-22(23)27(2)21(28)19(10-12-26-18-9-6-11-25-14-18)20-13-17(15-29-20)16-7-4-3-5-8-16;1-2-3/h3-9,11,13-15,19,26H,10,12H2,1-2H3,(H2,23,24);1H3 |
| InChIKey | FMEYCOPPBAUOGI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|