C24H28N2S — CID 145460589
3-ethylthiophene;N'-(2-methyl-1,1-diphenylprop-2-enyl)ethanimidamide (PubChem CID 145460589) has the molecular formula C24H28N2S and a molecular weight of 376.57 g/mol. Its IUPAC name is 3-ethylthiophene;N'-(2-methyl-1,1-diphenylprop-2-enyl)ethanimidamide.
| Compound Name | 3-ethylthiophene;N'-(2-methyl-1,1-diphenylprop-2-enyl)ethanimidamide |
|---|---|
| PubChem CID | 145460589 |
| Molecular Formula | C24H28N2S |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3-ethylthiophene;N'-(2-methyl-1,1-diphenylprop-2-enyl)ethanimidamide |
| SMILES | C=C(C)C(/N=C(\C)N)(c1ccccc1)c1ccccc1.CCc1ccsc1 |
| InChI | InChI=1S/C18H20N2.C6H8S/c1-14(2)18(20-15(3)19,16-10-6-4-7-11-16)17-12-8-5-9-13-17;1-2-6-3-4-7-5-6/h4-13H,1H2,2-3H3,(H2,19,20);3-5H,2H2,1H3 |
| InChIKey | ODCVQXCAWJAWLR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|