C36H47N3 — CID 145460555
N-(cyclopentylmethyl)-1-(3-ethylphenyl)ethenamine;ethene;N'-(2-methyl-1,1-diphenylprop-2-enyl)ethanimidamide (PubChem CID 145460555) has the molecular formula C36H47N3 and a molecular weight of 521.79 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-1-(3-ethylphenyl)ethenamine;ethene;N'-(2-methyl-1,1-diphenylprop-2-enyl)ethanimidamide.
| Compound Name | N-(cyclopentylmethyl)-1-(3-ethylphenyl)ethenamine;ethene;N'-(2-methyl-1,1-diphenylprop-2-enyl)ethanimidamide |
|---|---|
| PubChem CID | 145460555 |
| Molecular Formula | C36H47N3 |
| Molecular Weight | 521.79 g/mol |
| Exact Mass | 521.38 |
| IUPAC Name | N-(cyclopentylmethyl)-1-(3-ethylphenyl)ethenamine;ethene;N'-(2-methyl-1,1-diphenylprop-2-enyl)ethanimidamide |
| SMILES | C=C.C=C(C)C(/N=C(\C)N)(c1ccccc1)c1ccccc1.C=C(NCC1CCCC1)c1cccc(CC)c1 |
| InChI | InChI=1S/C18H20N2.C16H23N.C2H4/c1-14(2)18(20-15(3)19,16-10-6-4-7-11-16)17-12-8-5-9-13-17;1-3-14-9-6-10-16(11-14)13(2)17-12-15-7-4-5-8-15;1-2/h4-13H,1H2,2-3H3,(H2,19,20);6,9-11,15,17H,2-5,7-8,12H2,1H3;1-2H2 |
| InChIKey | RVTRHCUBKFVAHM-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.79 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|