C22H26N4 — CID 164589582
(1E,3Z)-1-N'-[3-[1-(cyclopropylmethylamino)ethenyl]phenyl]-4-phenylbuta-1,3-diene-1,1,4-triamine (PubChem CID 164589582) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is (1E,3Z)-1-N'-[3-[1-(cyclopropylmethylamino)ethenyl]phenyl]-4-phenylbuta-1,3-diene-1,1,4-triamine.
| Compound Name | (1E,3Z)-1-N'-[3-[1-(cyclopropylmethylamino)ethenyl]phenyl]-4-phenylbuta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 164589582 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | (1E,3Z)-1-N'-[3-[1-(cyclopropylmethylamino)ethenyl]phenyl]-4-phenylbuta-1,3-diene-1,1,4-triamine |
| SMILES | C=C(NCC1CC1)c1cccc(N/C(N)=C/C=C(\N)c2ccccc2)c1 |
| InChI | InChI=1S/C22H26N4/c1-16(25-15-17-10-11-17)19-8-5-9-20(14-19)26-22(24)13-12-21(23)18-6-3-2-4-7-18/h2-9,12-14,17,25-26H,1,10-11,15,23-24H2/b21-12-,22-13+ |
| InChIKey | WCAPKJAZPUBMCS-VZHHCOETSA-N |
| XLogP | 3.87 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|