C24H29FN4 — CID 164589795
(1E,3Z)-1-N'-[3-[1-(3-fluoroanilino)ethenyl]cyclohexyl]-4-phenylbuta-1,3-diene-1,1,4-triamine (PubChem CID 164589795) has the molecular formula C24H29FN4 and a molecular weight of 392.52 g/mol. Its IUPAC name is (1E,3Z)-1-N'-[3-[1-(3-fluoroanilino)ethenyl]cyclohexyl]-4-phenylbuta-1,3-diene-1,1,4-triamine.
| Compound Name | (1E,3Z)-1-N'-[3-[1-(3-fluoroanilino)ethenyl]cyclohexyl]-4-phenylbuta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 164589795 |
| Molecular Formula | C24H29FN4 |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (1E,3Z)-1-N'-[3-[1-(3-fluoroanilino)ethenyl]cyclohexyl]-4-phenylbuta-1,3-diene-1,1,4-triamine |
| SMILES | C=C(Nc1cccc(F)c1)C1CCCC(N/C(N)=C/C=C(\N)c2ccccc2)C1 |
| InChI | InChI=1S/C24H29FN4/c1-17(28-22-12-6-10-20(25)16-22)19-9-5-11-21(15-19)29-24(27)14-13-23(26)18-7-3-2-4-8-18/h2-4,6-8,10,12-14,16,19,21,28-29H,1,5,9,11,15,26-27H2/b23-13-,24-14+ |
| InChIKey | SZYVGYDJMFYBOI-NQGGHMMCSA-N |
| XLogP | 4.70 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|