C26H40N4 — CID 165128917
(1E,3Z)-4-cyclopropyl-1-N'-[3-[1-[(4-methylcyclopenta-1,3-dien-1-yl)methylamino]ethenyl]phenyl]buta-1,3-diene-1,1,4-triamine;ethane (PubChem CID 165128917) has the molecular formula C26H40N4 and a molecular weight of 408.63 g/mol. Its IUPAC name is (1E,3Z)-4-cyclopropyl-1-N'-[3-[1-[(4-methylcyclopenta-1,3-dien-1-yl)methylamino]ethenyl]phenyl]buta-1,3-diene-1,1,4-triamine;ethane.
| Compound Name | (1E,3Z)-4-cyclopropyl-1-N'-[3-[1-[(4-methylcyclopenta-1,3-dien-1-yl)methylamino]ethenyl]phenyl]buta-1,3-diene-1,1,4-triamine;ethane |
|---|---|
| PubChem CID | 165128917 |
| Molecular Formula | C26H40N4 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.33 |
| IUPAC Name | (1E,3Z)-4-cyclopropyl-1-N'-[3-[1-[(4-methylcyclopenta-1,3-dien-1-yl)methylamino]ethenyl]phenyl]buta-1,3-diene-1,1,4-triamine;ethane |
| SMILES | C=C(NCC1=CC=C(C)C1)c1cccc(N/C(N)=C/C=C(\N)C2CC2)c1.CC.CC |
| InChI | InChI=1S/C22H28N4.2C2H6/c1-15-6-7-17(12-15)14-25-16(2)19-4-3-5-20(13-19)26-22(24)11-10-21(23)18-8-9-18;2*1-2/h3-7,10-11,13,18,25-26H,2,8-9,12,14,23-24H2,1H3;2*1-2H3/b21-10-,22-11+;; |
| InChIKey | WWEDNMRLARQMSZ-VPXBMBDESA-N |
| XLogP | 6.04 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|