C24H35NO — CID 145461243
(5S)-2-ethyl-3-imino-5-methyl-5-[3-(3-phenylpropyl)cyclohexyl]cyclohexan-1-one (PubChem CID 145461243) has the molecular formula C24H35NO and a molecular weight of 353.55 g/mol. Its IUPAC name is (5S)-2-ethyl-3-imino-5-methyl-5-[3-(3-phenylpropyl)cyclohexyl]cyclohexan-1-one.
| Compound Name | (5S)-2-ethyl-3-imino-5-methyl-5-[3-(3-phenylpropyl)cyclohexyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 145461243 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | (5S)-2-ethyl-3-imino-5-methyl-5-[3-(3-phenylpropyl)cyclohexyl]cyclohexan-1-one |
| SMILES | [H]/N=C1\C[C@](C)(C2CCCC(CCCc3ccccc3)C2)CC(=O)C1CC |
| InChI | InChI=1S/C24H35NO/c1-3-21-22(25)16-24(2,17-23(21)26)20-14-8-13-19(15-20)12-7-11-18-9-5-4-6-10-18/h4-6,9-10,19-21,25H,3,7-8,11-17H2,1-2H3/b25-22+/t19?,20?,21?,24-/m0/s1 |
| InChIKey | SHDPRJBWYMMVPC-XQAQWRGASA-N |
| XLogP | 6.23 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|