About 2-cyclobutylethylbenzene;ethyl formate
2-cyclobutylethylbenzene;ethyl formate (PubChem CID 174903391) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-cyclobutylethylbenzene;ethyl formate.
Molecular Properties
| Compound Name | 2-cyclobutylethylbenzene;ethyl formate |
| PubChem CID | 174903391 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-cyclobutylethylbenzene;ethyl formate |
| SMILES | CCOC=O.c1ccc(CCC2CCC2)cc1 |
| InChI | InChI=1S/C12H16.C3H6O2/c1-2-5-11(6-3-1)9-10-12-7-4-8-12;1-2-5-3-4/h1-3,5-6,12H,4,7-10H2;3H,2H2,1H3 |
| InChIKey | CPPCSBBQCLJKJF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclobutylethylbenzene;ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylethylbenzene;ethyl formate?
The IUPAC name of 2-cyclobutylethylbenzene;ethyl formate (CID 174903391) is 2-cyclobutylethylbenzene;ethyl formate.
What is the SMILES notation for 2-cyclobutylethylbenzene;ethyl formate?
The canonical SMILES for 2-cyclobutylethylbenzene;ethyl formate is CCOC=O.c1ccc(CCC2CCC2)cc1.
What is the InChIKey of 2-cyclobutylethylbenzene;ethyl formate?
The InChIKey is CPPCSBBQCLJKJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C3H6O2/c1-2-5-11(6-3-1)9-10-12-7-4-8-12;1-2-5-3-4/h1-3,5-6,12H,4,7-10H2;3H,2H2,1H3.
What are the key properties of 2-cyclobutylethylbenzene;ethyl formate?
2-cyclobutylethylbenzene;ethyl formate has a molecular weight of 234.34 g/mol, XLogP of 3.60, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylethylbenzene;ethyl formate is sourced from PubChem (CID 174903391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).