C25H17NO4 — CID 14546185
2-[(5-oxo-3-phenyl-4H-1,2-oxazol-4-yl)-phenylmethyl]indene-1,3-dione (PubChem CID 14546185) has the molecular formula C25H17NO4 and a molecular weight of 395.41 g/mol. Its IUPAC name is 2-[(5-oxo-3-phenyl-4H-1,2-oxazol-4-yl)-phenylmethyl]indene-1,3-dione.
| Compound Name | 2-[(5-oxo-3-phenyl-4H-1,2-oxazol-4-yl)-phenylmethyl]indene-1,3-dione |
|---|---|
| PubChem CID | 14546185 |
| Molecular Formula | C25H17NO4 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-[(5-oxo-3-phenyl-4H-1,2-oxazol-4-yl)-phenylmethyl]indene-1,3-dione |
| SMILES | O=C1ON=C(c2ccccc2)C1C(c1ccccc1)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H17NO4/c27-23-17-13-7-8-14-18(17)24(28)21(23)19(15-9-3-1-4-10-15)20-22(26-30-25(20)29)16-11-5-2-6-12-16/h1-14,19-21H |
| InChIKey | PGPRUNQVGWBNKF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|