About N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine
N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine (PubChem CID 145462180) has the molecular formula C17H22N4O
and a molecular weight of 298.39 g/mol. Its IUPAC name is N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine.
Molecular Properties
| Compound Name | N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine |
| PubChem CID | 145462180 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine |
| SMILES | CNC(C)CC(=O)/N=C/N.c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C11H9N.C6H13N3O/c1-2-5-10(6-3-1)11-7-4-8-12-9-11;1-5(8-2)3-6(10)9-4-7/h1-9H;4-5,8H,3H2,1-2H3,(H2,7,9,10) |
| InChIKey | XAMRMJNCSCPTKY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine?
The IUPAC name of N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine (CID 145462180) is N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine.
What is the SMILES notation for N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine?
The canonical SMILES for N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine is CNC(C)CC(=O)/N=C/N.c1ccc(-c2cccnc2)cc1.
What is the InChIKey of N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine?
The InChIKey is XAMRMJNCSCPTKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N.C6H13N3O/c1-2-5-10(6-3-1)11-7-4-8-12-9-11;1-5(8-2)3-6(10)9-4-7/h1-9H;4-5,8H,3H2,1-2H3,(H2,7,9,10).
What are the key properties of N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine?
N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine has a molecular weight of 298.39 g/mol, XLogP of 2.25, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(aminomethylidene)-3-(methylamino)butanamide;3-phenylpyridine is sourced from PubChem (CID 145462180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).