C13H16N4O2S — CID 123414348
5-(aminomethylideneamino)-3,4-dimethyl-5-pyridin-3-ylimino-2-sulfanylidenepentanoic acid (PubChem CID 123414348) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 5-(aminomethylideneamino)-3,4-dimethyl-5-pyridin-3-ylimino-2-sulfanylidenepentanoic acid.
| Compound Name | 5-(aminomethylideneamino)-3,4-dimethyl-5-pyridin-3-ylimino-2-sulfanylidenepentanoic acid |
|---|---|
| PubChem CID | 123414348 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 5-(aminomethylideneamino)-3,4-dimethyl-5-pyridin-3-ylimino-2-sulfanylidenepentanoic acid |
| SMILES | CC(C(=S)C(=O)O)C(C)C(=N/c1cccnc1)/N=C/N |
| InChI | InChI=1S/C13H16N4O2S/c1-8(11(20)13(18)19)9(2)12(16-7-14)17-10-4-3-5-15-6-10/h3-9H,1-2H3,(H,18,19)(H2,14,16,17) |
| InChIKey | BMHQLLNASJBHAP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|