About ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine
ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine (PubChem CID 145462378) has the molecular formula C15H28N2
and a molecular weight of 236.40 g/mol. Its IUPAC name is ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine |
| PubChem CID | 145462378 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine |
| SMILES | CC.CCCc1ccc(N)cc1N(C)CCC |
| InChI | InChI=1S/C13H22N2.C2H6/c1-4-6-11-7-8-12(14)10-13(11)15(3)9-5-2;1-2/h7-8,10H,4-6,9,14H2,1-3H3;1-2H3 |
| InChIKey | QMWZTCOOSOKDIG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine?
The IUPAC name of ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine (CID 145462378) is ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine.
What is the SMILES notation for ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine?
The canonical SMILES for ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine is CC.CCCc1ccc(N)cc1N(C)CCC.
What is the InChIKey of ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine?
The InChIKey is QMWZTCOOSOKDIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2.C2H6/c1-4-6-11-7-8-12(14)10-13(11)15(3)9-5-2;1-2/h7-8,10H,4-6,9,14H2,1-3H3;1-2H3.
What are the key properties of ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine?
ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine has a molecular weight of 236.40 g/mol, XLogP of 4.09, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-N-methyl-3-N,4-dipropylbenzene-1,3-diamine is sourced from PubChem (CID 145462378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).