C20H36N2O3 — CID 145465759
(Z,2E)-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-ethylidene-5-methylidenehept-3-enamide;(Z)-but-2-ene (PubChem CID 145465759) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is (Z,2E)-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-ethylidene-5-methylidenehept-3-enamide;(Z)-but-2-ene.
| Compound Name | (Z,2E)-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-ethylidene-5-methylidenehept-3-enamide;(Z)-but-2-ene |
|---|---|
| PubChem CID | 145465759 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | (Z,2E)-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-ethylidene-5-methylidenehept-3-enamide;(Z)-but-2-ene |
| SMILES | C/C=C\C.C=C(/C=C\C(=C/C)C(=O)NCCOCCOCCN)CC |
| InChI | InChI=1S/C16H28N2O3.C4H8/c1-4-14(3)6-7-15(5-2)16(19)18-9-11-21-13-12-20-10-8-17;1-3-4-2/h5-7H,3-4,8-13,17H2,1-2H3,(H,18,19);3-4H,1-2H3/b7-6-,15-5+;4-3- |
| InChIKey | AGUUONIRDQRTGO-RCQKGZLKSA-N |
| XLogP | 3.15 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|