C20H28N2O3 — CID 59035240
(E)-2-methyl-N-[2-[2-[[(E)-2-methylhept-2-en-6-ynoyl]amino]ethoxy]ethyl]hept-2-en-6-ynamide (PubChem CID 59035240) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (E)-2-methyl-N-[2-[2-[[(E)-2-methylhept-2-en-6-ynoyl]amino]ethoxy]ethyl]hept-2-en-6-ynamide.
| Compound Name | (E)-2-methyl-N-[2-[2-[[(E)-2-methylhept-2-en-6-ynoyl]amino]ethoxy]ethyl]hept-2-en-6-ynamide |
|---|---|
| PubChem CID | 59035240 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (E)-2-methyl-N-[2-[2-[[(E)-2-methylhept-2-en-6-ynoyl]amino]ethoxy]ethyl]hept-2-en-6-ynamide |
| SMILES | C#CCC/C=C(\C)C(=O)NCCOCCNC(=O)/C(C)=C/CCC#C |
| InChI | InChI=1S/C20H28N2O3/c1-5-7-9-11-17(3)19(23)21-13-15-25-16-14-22-20(24)18(4)12-10-8-6-2/h1-2,11-12H,7-10,13-16H2,3-4H3,(H,21,23)(H,22,24)/b17-11+,18-12+ |
| InChIKey | ICLQGCLVIHRRCB-JYFOCSDGSA-N |
| XLogP | 1.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|