C12H21NO3 — CID 167448169
(2E)-5-methyl-4-oxo-N-(2-propoxyethyl)hexa-2,5-dienamide;molecular hydrogen (PubChem CID 167448169) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is (2E)-5-methyl-4-oxo-N-(2-propoxyethyl)hexa-2,5-dienamide;molecular hydrogen.
| Compound Name | (2E)-5-methyl-4-oxo-N-(2-propoxyethyl)hexa-2,5-dienamide;molecular hydrogen |
|---|---|
| PubChem CID | 167448169 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | (2E)-5-methyl-4-oxo-N-(2-propoxyethyl)hexa-2,5-dienamide;molecular hydrogen |
| SMILES | C=C(C)C(=O)/C=C/C(=O)NCCOCCC.[H][H] |
| InChI | InChI=1S/C12H19NO3.H2/c1-4-8-16-9-7-13-12(15)6-5-11(14)10(2)3;/h5-6H,2,4,7-9H2,1,3H3,(H,13,15);1H/b6-5+; |
| InChIKey | LBEGRFAMHBOQGM-IPZCTEOASA-N |
| XLogP | 1.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|