C15H29NO2 — CID 123371623
4-methyl-N-[2-(3-methylpentan-3-yloxy)ethyl]hex-2-enamide (PubChem CID 123371623) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 4-methyl-N-[2-(3-methylpentan-3-yloxy)ethyl]hex-2-enamide.
| Compound Name | 4-methyl-N-[2-(3-methylpentan-3-yloxy)ethyl]hex-2-enamide |
|---|---|
| PubChem CID | 123371623 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 4-methyl-N-[2-(3-methylpentan-3-yloxy)ethyl]hex-2-enamide |
| SMILES | CCC(C)C=CC(=O)NCCOC(C)(CC)CC |
| InChI | InChI=1S/C15H29NO2/c1-6-13(4)9-10-14(17)16-11-12-18-15(5,7-2)8-3/h9-10,13H,6-8,11-12H2,1-5H3,(H,16,17) |
| InChIKey | RPDXWKBFVWZIPZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|