C15H27NO4 — CID 167420659
(E)-5-methyl-N-[2-[2-(2-methylpropoxy)ethoxy]ethyl]-4-oxohex-2-enamide (PubChem CID 167420659) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is (E)-5-methyl-N-[2-[2-(2-methylpropoxy)ethoxy]ethyl]-4-oxohex-2-enamide.
| Compound Name | (E)-5-methyl-N-[2-[2-(2-methylpropoxy)ethoxy]ethyl]-4-oxohex-2-enamide |
|---|---|
| PubChem CID | 167420659 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (E)-5-methyl-N-[2-[2-(2-methylpropoxy)ethoxy]ethyl]-4-oxohex-2-enamide |
| SMILES | CC(C)COCCOCCNC(=O)/C=C/C(=O)C(C)C |
| InChI | InChI=1S/C15H27NO4/c1-12(2)11-20-10-9-19-8-7-16-15(18)6-5-14(17)13(3)4/h5-6,12-13H,7-11H2,1-4H3,(H,16,18)/b6-5+ |
| InChIKey | VCLPIQVMJZXTAC-AATRIKPKSA-N |
| XLogP | 1.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|