C13H23NO3 — CID 148512966
N-[2-[(E)-7-methyl-4-oxooct-5-enoxy]ethyl]acetamide (PubChem CID 148512966) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is N-[2-[(E)-7-methyl-4-oxooct-5-enoxy]ethyl]acetamide.
| Compound Name | N-[2-[(E)-7-methyl-4-oxooct-5-enoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 148512966 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | N-[2-[(E)-7-methyl-4-oxooct-5-enoxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOCCCC(=O)/C=C/C(C)C |
| InChI | InChI=1S/C13H23NO3/c1-11(2)6-7-13(16)5-4-9-17-10-8-14-12(3)15/h6-7,11H,4-5,8-10H2,1-3H3,(H,14,15)/b7-6+ |
| InChIKey | MMWDPLSHMDSUBL-VOTSOKGWSA-N |
| XLogP | 1.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|